C18H21F3N6O3S — CID 161242905
5-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentane-2-sulfonamide (PubChem CID 161242905) has the molecular formula C18H21F3N6O3S and a molecular weight of 458.47 g/mol. Its IUPAC name is 5-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentane-2-sulfonamide.
| Compound Name | 5-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentane-2-sulfonamide |
|---|---|
| PubChem CID | 161242905 |
| Molecular Formula | C18H21F3N6O3S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pentane-2-sulfonamide |
| SMILES | CC(CCCNc1nc(Nc2ccc3c(c2)CC(=O)N3)ncc1C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C18H21F3N6O3S/c1-10(31(22,29)30)3-2-6-23-16-13(18(19,20)21)9-24-17(27-16)25-12-4-5-14-11(7-12)8-15(28)26-14/h4-5,7,9-10H,2-3,6,8H2,1H3,(H,26,28)(H2,22,29,30)(H2,23,24,25,27) |
| InChIKey | VAGBXNUPWYMQMC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|