C19H23F3N6O3S — CID 172818265
N-[3-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]propane-2-sulfonamide (PubChem CID 172818265) has the molecular formula C19H23F3N6O3S and a molecular weight of 472.49 g/mol. Its IUPAC name is N-[3-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]propane-2-sulfonamide.
| Compound Name | N-[3-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 172818265 |
| Molecular Formula | C19H23F3N6O3S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[3-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCNc1nc(Nc2ccc3c(c2)CC(=O)N3)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H23F3N6O3S/c1-11(2)32(30,31)25-7-3-6-23-17-14(19(20,21)22)10-24-18(28-17)26-13-4-5-15-12(8-13)9-16(29)27-15/h4-5,8,10-11,25H,3,6-7,9H2,1-2H3,(H,27,29)(H2,23,24,26,28) |
| InChIKey | TWDOCRYNVGAEAR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|