C26H40F3N5O — CID 177204223
ethane;N-[3-[[2-(2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide (PubChem CID 177204223) has the molecular formula C26H40F3N5O and a molecular weight of 495.63 g/mol. Its IUPAC name is ethane;N-[3-[[2-(2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide.
| Compound Name | ethane;N-[3-[[2-(2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 177204223 |
| Molecular Formula | C26H40F3N5O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | ethane;N-[3-[[2-(2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide |
| SMILES | CC.CCCCCC(=O)N(CCC)CCCNc1nc(Nc2ccccc2C)ncc1C(F)(F)F |
| InChI | InChI=1S/C24H34F3N5O.C2H6/c1-4-6-7-13-21(33)32(15-5-2)16-10-14-28-22-19(24(25,26)27)17-29-23(31-22)30-20-12-9-8-11-18(20)3;1-2/h8-9,11-12,17H,4-7,10,13-16H2,1-3H3,(H2,28,29,30,31);1-2H3 |
| InChIKey | QNOOMVVQCVOKKP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|