C18H26F3N7O — CID 174690384
2-methyl-2-[5-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]heptanamide (PubChem CID 174690384) has the molecular formula C18H26F3N7O and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-methyl-2-[5-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]heptanamide.
| Compound Name | 2-methyl-2-[5-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]heptanamide |
|---|---|
| PubChem CID | 174690384 |
| Molecular Formula | C18H26F3N7O |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-methyl-2-[5-methyl-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]heptanamide |
| SMILES | CCCCCC(C)(C(N)=O)n1ncc(Nc2ncc(C(F)(F)F)c(NC)n2)c1C |
| InChI | InChI=1S/C18H26F3N7O/c1-5-6-7-8-17(3,15(22)29)28-11(2)13(10-25-28)26-16-24-9-12(18(19,20)21)14(23-4)27-16/h9-10H,5-8H2,1-4H3,(H2,22,29)(H2,23,24,26,27) |
| InChIKey | BNSGAOUFOQCHLY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|