C13H12F3N5O — CID 174917876
4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide (PubChem CID 174917876) has the molecular formula C13H12F3N5O and a molecular weight of 311.27 g/mol. Its IUPAC name is 4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 174917876 |
| Molecular Formula | C13H12F3N5O |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
| SMILES | CNc1nc(Nc2ccc(C(N)=O)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C13H12F3N5O/c1-18-11-9(13(14,15)16)6-19-12(21-11)20-8-4-2-7(3-5-8)10(17)22/h2-6H,1H3,(H2,17,22)(H2,18,19,20,21) |
| InChIKey | NYMBUZXLLCDPBM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |