C14H14ClF3N8 — CID 154034222
3-chloro-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N'-(methyldiazenyl)benzenecarboximidamide (PubChem CID 154034222) has the molecular formula C14H14ClF3N8 and a molecular weight of 386.77 g/mol. Its IUPAC name is 3-chloro-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N'-(methyldiazenyl)benzenecarboximidamide.
| Compound Name | 3-chloro-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N'-(methyldiazenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 154034222 |
| Molecular Formula | C14H14ClF3N8 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-chloro-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N'-(methyldiazenyl)benzenecarboximidamide |
| SMILES | C/N=N/N=C(N)c1ccc(Nc2ncc(C(F)(F)F)c(NC)n2)c(Cl)c1 |
| InChI | InChI=1S/C14H14ClF3N8/c1-20-12-8(14(16,17)18)6-22-13(24-12)23-10-4-3-7(5-9(10)15)11(19)25-26-21-2/h3-6H,1-2H3,(H2,19,21,25)(H2,20,22,23,24) |
| InChIKey | ZUUCCRBPKSPIEP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|