C15H17F3N6O — CID 174320128
2-N-[3-amino-4-methoxy-2-(methyliminomethyl)phenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 174320128) has the molecular formula C15H17F3N6O and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-N-[3-amino-4-methoxy-2-(methyliminomethyl)phenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-amino-4-methoxy-2-(methyliminomethyl)phenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174320128 |
| Molecular Formula | C15H17F3N6O |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-N-[3-amino-4-methoxy-2-(methyliminomethyl)phenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | C/N=C/c1c(Nc2ncc(C(F)(F)F)c(NC)n2)ccc(OC)c1N |
| InChI | InChI=1S/C15H17F3N6O/c1-20-6-8-10(4-5-11(25-3)12(8)19)23-14-22-7-9(15(16,17)18)13(21-2)24-14/h4-7H,19H2,1-3H3,(H2,21,22,23,24)/b20-6+ |
| InChIKey | QYKVSTVIOICVHU-CGOBSMCZSA-N |
| XLogP | 2.92 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|