C13H12ClF3N8 — CID 126496782
3-chloro-N-hydrazinylidene-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzenecarboximidamide (PubChem CID 126496782) has the molecular formula C13H12ClF3N8 and a molecular weight of 372.74 g/mol. Its IUPAC name is 3-chloro-N-hydrazinylidene-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzenecarboximidamide.
| Compound Name | 3-chloro-N-hydrazinylidene-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 126496782 |
| Molecular Formula | C13H12ClF3N8 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-chloro-N-hydrazinylidene-4-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc(Nc2ncc(C(F)(F)F)c(NC)n2)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClF3N8/c1-20-11-7(13(15,16)17)5-21-12(23-11)22-9-3-2-6(4-8(9)14)10(18)24-25-19/h2-5H,1H3,(H3,18,19,24)(H2,20,21,22,23) |
| InChIKey | ZCLDYDYBJSOGBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|