C20H22F3N7O2 — CID 174321800
(E)-3-[3-amino-4-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 174321800) has the molecular formula C20H22F3N7O2 and a molecular weight of 449.44 g/mol. Its IUPAC name is (E)-3-[3-amino-4-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-amino-4-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 174321800 |
| Molecular Formula | C20H22F3N7O2 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (E)-3-[3-amino-4-methanimidoyl-5-[[4-(methylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)cc(/C=C/C(=O)N2CCOCC2)cc1Nc1ncc(C(F)(F)F)c(NC)n1 |
| InChI | InChI=1S/C20H22F3N7O2/c1-26-18-14(20(21,22)23)11-27-19(29-18)28-16-9-12(8-15(25)13(16)10-24)2-3-17(31)30-4-6-32-7-5-30/h2-3,8-11,24H,4-7,25H2,1H3,(H2,26,27,28,29)/b3-2+,24-10+ |
| InChIKey | OPPZHZGDANYDNX-MAPVVWMBSA-N |
| XLogP | 2.73 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|