C18H21F4N5O2 — CID 141339238
2-N-[2-(2-fluoroethoxy)-4-morpholin-4-ylphenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 141339238) has the molecular formula C18H21F4N5O2 and a molecular weight of 415.39 g/mol. Its IUPAC name is 2-N-[2-(2-fluoroethoxy)-4-morpholin-4-ylphenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(2-fluoroethoxy)-4-morpholin-4-ylphenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141339238 |
| Molecular Formula | C18H21F4N5O2 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-N-[2-(2-fluoroethoxy)-4-morpholin-4-ylphenyl]-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(N3CCOCC3)cc2OCCF)ncc1C(F)(F)F |
| InChI | InChI=1S/C18H21F4N5O2/c1-23-16-13(18(20,21)22)11-24-17(26-16)25-14-3-2-12(10-15(14)29-7-4-19)27-5-8-28-9-6-27/h2-3,10-11H,4-9H2,1H3,(H2,23,24,25,26) |
| InChIKey | HGHYYCGUCSEZRI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|