C18H15N5O3 — CID 143285070
4-[(4-anilino-5-carbamoylpyrimidin-2-yl)amino]benzoic acid (PubChem CID 143285070) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-[(4-anilino-5-carbamoylpyrimidin-2-yl)amino]benzoic acid.
| Compound Name | 4-[(4-anilino-5-carbamoylpyrimidin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 143285070 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(4-anilino-5-carbamoylpyrimidin-2-yl)amino]benzoic acid |
| SMILES | NC(=O)c1cnc(Nc2ccc(C(=O)O)cc2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C18H15N5O3/c19-15(24)14-10-20-18(22-13-8-6-11(7-9-13)17(25)26)23-16(14)21-12-4-2-1-3-5-12/h1-10H,(H2,19,24)(H,25,26)(H2,20,21,22,23) |
| InChIKey | KWSOPRUEEQOISF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |