C17H21N5O2 — CID 123646313
4-anilino-2-[(2-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide (PubChem CID 123646313) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 4-anilino-2-[(2-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-anilino-2-[(2-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123646313 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-anilino-2-[(2-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCCCC2O)nc1Nc1ccccc1 |
| InChI | InChI=1S/C17H21N5O2/c18-15(24)12-10-19-17(21-13-8-4-5-9-14(13)23)22-16(12)20-11-6-2-1-3-7-11/h1-3,6-7,10,13-14,23H,4-5,8-9H2,(H2,18,24)(H2,19,20,21,22) |
| InChIKey | LAZDMTMTGXWECM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |