C14H16N6O3 — CID 18460852
3-[[2-(2-aminoethylamino)-5-carbamoylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 18460852) has the molecular formula C14H16N6O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-[[2-(2-aminoethylamino)-5-carbamoylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[2-(2-aminoethylamino)-5-carbamoylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 18460852 |
| Molecular Formula | C14H16N6O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-[[2-(2-aminoethylamino)-5-carbamoylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | NCCNc1ncc(C(N)=O)c(Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C14H16N6O3/c15-4-5-17-14-18-7-10(11(16)21)12(20-14)19-9-3-1-2-8(6-9)13(22)23/h1-3,6-7H,4-5,15H2,(H2,16,21)(H,22,23)(H2,17,18,19,20) |
| InChIKey | VYFSBTXRITZCCZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |