C16H22N9O+ — CID 143890460
[3-[[2-(3-aminopropylamino)-5-carbamoylpyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium (PubChem CID 143890460) has the molecular formula C16H22N9O+ and a molecular weight of 356.41 g/mol. Its IUPAC name is [3-[[2-(3-aminopropylamino)-5-carbamoylpyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium.
| Compound Name | [3-[[2-(3-aminopropylamino)-5-carbamoylpyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium |
|---|---|
| PubChem CID | 143890460 |
| Molecular Formula | C16H22N9O+ |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | [3-[[2-(3-aminopropylamino)-5-carbamoylpyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium |
| SMILES | [H]/N=C/C=N\[NH2+]c1cccc(Nc2nc(NCCCN)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C16H21N9O/c17-5-2-7-20-16-21-10-13(14(19)26)15(24-16)23-11-3-1-4-12(9-11)25-22-8-6-18/h1,3-4,6,8-10,18,25H,2,5,7,17H2,(H2,19,26)(H2,20,21,23,24)/p+1/b18-6+,22-8- |
| InChIKey | YNNNFQNVCBYXMH-SFKUMIQRSA-O |
| XLogP | -0.09 |
| TPSA | 171.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|