C18H28N9O+ — CID 143890590
[3-[[5-[amino(hydroxy)methyl]-2-[[(2R)-1-amino-3-methylbutan-2-yl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium (PubChem CID 143890590) has the molecular formula C18H28N9O+ and a molecular weight of 386.48 g/mol. Its IUPAC name is [3-[[5-[amino(hydroxy)methyl]-2-[[(2R)-1-amino-3-methylbutan-2-yl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium.
| Compound Name | [3-[[5-[amino(hydroxy)methyl]-2-[[(2R)-1-amino-3-methylbutan-2-yl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium |
|---|---|
| PubChem CID | 143890590 |
| Molecular Formula | C18H28N9O+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | [3-[[5-[amino(hydroxy)methyl]-2-[[(2R)-1-amino-3-methylbutan-2-yl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium |
| SMILES | [H]/N=C/C=N\[NH2+]c1cccc(Nc2nc(N[C@@H](CN)C(C)C)ncc2C(N)O)c1 |
| InChI | InChI=1S/C18H27N9O/c1-11(2)15(9-20)25-18-22-10-14(16(21)28)17(26-18)24-12-4-3-5-13(8-12)27-23-7-6-19/h3-8,10-11,15-16,19,27-28H,9,20-21H2,1-2H3,(H2,22,24,25,26)/p+1/b19-6+,23-7-/t15-,16?/m0/s1 |
| InChIKey | ICGWJVSLXQLTLL-KOGMXSPGSA-O |
| XLogP | 0.40 |
| TPSA | 174.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|