C20H28N9O2+ — CID 143890615
[3-[[2-[[(1R,2S)-2-aminocyclohexyl]amino]-5-carbamoylpyrimidin-4-yl]amino]-5-methoxyphenyl]-[(Z)-2-iminoethylideneamino]azanium (PubChem CID 143890615) has the molecular formula C20H28N9O2+ and a molecular weight of 426.51 g/mol. Its IUPAC name is [3-[[2-[[(1R,2S)-2-aminocyclohexyl]amino]-5-carbamoylpyrimidin-4-yl]amino]-5-methoxyphenyl]-[(Z)-2-iminoethylideneamino]azanium.
| Compound Name | [3-[[2-[[(1R,2S)-2-aminocyclohexyl]amino]-5-carbamoylpyrimidin-4-yl]amino]-5-methoxyphenyl]-[(Z)-2-iminoethylideneamino]azanium |
|---|---|
| PubChem CID | 143890615 |
| Molecular Formula | C20H28N9O2+ |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [3-[[2-[[(1R,2S)-2-aminocyclohexyl]amino]-5-carbamoylpyrimidin-4-yl]amino]-5-methoxyphenyl]-[(Z)-2-iminoethylideneamino]azanium |
| SMILES | [H]/N=C/C=N\[NH2+]c1cc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)ncc2C(N)=O)cc(OC)c1 |
| InChI | InChI=1S/C20H27N9O2/c1-31-14-9-12(8-13(10-14)29-25-7-6-21)26-19-15(18(23)30)11-24-20(28-19)27-17-5-3-2-4-16(17)22/h6-11,16-17,21,29H,2-5,22H2,1H3,(H2,23,30)(H2,24,26,27,28)/p+1/b21-6+,25-7-/t16-,17+/m0/s1 |
| InChIKey | HTPTVHVWPZGQOK-ZKPXPFHNSA-O |
| XLogP | 0.84 |
| TPSA | 181.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|