C20H26BrN8O+ — CID 143890643
[2-bromo-5-[[5-carbamoyl-2-[[(1R)-3-methylcyclohexyl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium (PubChem CID 143890643) has the molecular formula C20H26BrN8O+ and a molecular weight of 474.39 g/mol. Its IUPAC name is [2-bromo-5-[[5-carbamoyl-2-[[(1R)-3-methylcyclohexyl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium.
| Compound Name | [2-bromo-5-[[5-carbamoyl-2-[[(1R)-3-methylcyclohexyl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium |
|---|---|
| PubChem CID | 143890643 |
| Molecular Formula | C20H26BrN8O+ |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [2-bromo-5-[[5-carbamoyl-2-[[(1R)-3-methylcyclohexyl]amino]pyrimidin-4-yl]amino]phenyl]-[(Z)-2-iminoethylideneamino]azanium |
| SMILES | [H]/N=C/C=N\[NH2+]c1cc(Nc2nc(N[C@@H]3CCCC(C)C3)ncc2C(N)=O)ccc1Br |
| InChI | InChI=1S/C20H25BrN8O/c1-12-3-2-4-13(9-12)27-20-24-11-15(18(23)30)19(28-20)26-14-5-6-16(21)17(10-14)29-25-8-7-22/h5-8,10-13,22,29H,2-4,9H2,1H3,(H2,23,30)(H2,24,26,27,28)/p+1/b22-7+,25-8-/t12?,13-/m1/s1 |
| InChIKey | MZDRHFLRGMICBN-JARNMBNGSA-O |
| XLogP | 2.90 |
| TPSA | 145.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|