C19H21N9O2 — CID 143890456
2-[[(1R,3S)-3-hydroxy-2-iminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 143890456) has the molecular formula C19H21N9O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[[(1R,3S)-3-hydroxy-2-iminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-[[(1R,3S)-3-hydroxy-2-iminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 143890456 |
| Molecular Formula | C19H21N9O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[[(1R,3S)-3-hydroxy-2-iminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | [H]/N=C1\[C@@H](O)CCC[C@H]1Nc1ncc(C(N)=O)c(Nc2cccc(-n3nccn3)c2)n1 |
| InChI | InChI=1S/C19H21N9O2/c20-16-14(5-2-6-15(16)29)26-19-22-10-13(17(21)30)18(27-19)25-11-3-1-4-12(9-11)28-23-7-8-24-28/h1,3-4,7-10,14-15,20,29H,2,5-6H2,(H2,21,30)(H2,22,25,26,27)/b20-16-/t14-,15+/m1/s1 |
| InChIKey | LTGOVZWZGRJVBE-JXGZPRAZSA-N |
| XLogP | 1.24 |
| TPSA | 167.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|