C19H26N9O2+ — CID 147655393
[3-[[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-5-carbamoylpyrimidin-4-yl]amino]phenyl]-(2-iminoethylideneamino)azanium (PubChem CID 147655393) has the molecular formula C19H26N9O2+ and a molecular weight of 412.48 g/mol. Its IUPAC name is [3-[[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-5-carbamoylpyrimidin-4-yl]amino]phenyl]-(2-iminoethylideneamino)azanium.
| Compound Name | [3-[[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-5-carbamoylpyrimidin-4-yl]amino]phenyl]-(2-iminoethylideneamino)azanium |
|---|---|
| PubChem CID | 147655393 |
| Molecular Formula | C19H26N9O2+ |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [3-[[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-5-carbamoylpyrimidin-4-yl]amino]phenyl]-(2-iminoethylideneamino)azanium |
| SMILES | [H]/N=C/C=N[NH2+]c1cccc(Nc2nc(NC(CC(C)C)C(N)=O)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C19H25N9O2/c1-11(2)8-15(17(22)30)26-19-23-10-14(16(21)29)18(27-19)25-12-4-3-5-13(9-12)28-24-7-6-20/h3-7,9-11,15,20,28H,8H2,1-2H3,(H2,21,29)(H2,22,30)(H2,23,25,26,27)/p+1/b20-6+,24-7? |
| InChIKey | GKHPGKWKEQQGOX-KMDJXRLPSA-O |
| XLogP | 0.46 |
| TPSA | 188.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|