C21H30N8O3 — CID 70952856
4-[4-(2-acetamidoethylamino)anilino]-2-[[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]amino]pyrimidine-5-carboxamide (PubChem CID 70952856) has the molecular formula C21H30N8O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[4-(2-acetamidoethylamino)anilino]-2-[[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[4-(2-acetamidoethylamino)anilino]-2-[[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70952856 |
| Molecular Formula | C21H30N8O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-[4-(2-acetamidoethylamino)anilino]-2-[[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]amino]pyrimidine-5-carboxamide |
| SMILES | CC(=O)NCCNc1ccc(Nc2nc(N[C@H](CC(C)C)C(N)=O)ncc2C(N)=O)cc1 |
| InChI | InChI=1S/C21H30N8O3/c1-12(2)10-17(19(23)32)28-21-26-11-16(18(22)31)20(29-21)27-15-6-4-14(5-7-15)25-9-8-24-13(3)30/h4-7,11-12,17,25H,8-10H2,1-3H3,(H2,22,31)(H2,23,32)(H,24,30)(H2,26,27,28,29)/t17-/m1/s1 |
| InChIKey | AGIXQZDOOZVETF-QGZVFWFLSA-N |
| XLogP | 1.18 |
| TPSA | 177.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|