C23H32N8O3 — CID 67184791
4-[4-(4-acetylpiperazin-1-yl)anilino]-2-[(5-amino-4-methyl-5-oxopentan-2-yl)amino]pyrimidine-5-carboxamide (PubChem CID 67184791) has the molecular formula C23H32N8O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-[4-(4-acetylpiperazin-1-yl)anilino]-2-[(5-amino-4-methyl-5-oxopentan-2-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[4-(4-acetylpiperazin-1-yl)anilino]-2-[(5-amino-4-methyl-5-oxopentan-2-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67184791 |
| Molecular Formula | C23H32N8O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 4-[4-(4-acetylpiperazin-1-yl)anilino]-2-[(5-amino-4-methyl-5-oxopentan-2-yl)amino]pyrimidine-5-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3nc(NC(C)CC(C)C(N)=O)ncc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C23H32N8O3/c1-14(20(24)33)12-15(2)27-23-26-13-19(21(25)34)22(29-23)28-17-4-6-18(7-5-17)31-10-8-30(9-11-31)16(3)32/h4-7,13-15H,8-12H2,1-3H3,(H2,24,33)(H2,25,34)(H2,26,27,28,29) |
| InChIKey | XXLDEZIFYNAVHL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|