C22H29N7O2 — CID 66792154
2-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(1-methylcyclobutyl)amino]pyrimidine-5-carboxamide (PubChem CID 66792154) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(1-methylcyclobutyl)amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(1-methylcyclobutyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66792154 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)anilino]-4-[(1-methylcyclobutyl)amino]pyrimidine-5-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3ncc(C(N)=O)c(NC4(C)CCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H29N7O2/c1-15(30)28-10-12-29(13-11-28)17-6-4-16(5-7-17)25-21-24-14-18(19(23)31)20(26-21)27-22(2)8-3-9-22/h4-7,14H,3,8-13H2,1-2H3,(H2,23,31)(H2,24,25,26,27) |
| InChIKey | CCFHYTQANHSKHH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|