C20H25N7O2 — CID 58014896
2-[4-(4-carbamoylpiperidin-1-yl)anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide (PubChem CID 58014896) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[4-(4-carbamoylpiperidin-1-yl)anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(4-carbamoylpiperidin-1-yl)anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58014896 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[4-(4-carbamoylpiperidin-1-yl)anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCC(C(N)=O)CC3)cc2)nc1NC1CC1 |
| InChI | InChI=1S/C20H25N7O2/c21-17(28)12-7-9-27(10-8-12)15-5-3-14(4-6-15)25-20-23-11-16(18(22)29)19(26-20)24-13-1-2-13/h3-6,11-13H,1-2,7-10H2,(H2,21,28)(H2,22,29)(H2,23,24,25,26) |
| InChIKey | YSRDYJWFCIHHCN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|