C18H23N7O — CID 76902551
5-(cyclobutylamino)-3-(4-pyrrolidin-1-ylanilino)-1,2,4-triazine-6-carboxamide (PubChem CID 76902551) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 5-(cyclobutylamino)-3-(4-pyrrolidin-1-ylanilino)-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-(cyclobutylamino)-3-(4-pyrrolidin-1-ylanilino)-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 76902551 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 5-(cyclobutylamino)-3-(4-pyrrolidin-1-ylanilino)-1,2,4-triazine-6-carboxamide |
| SMILES | NC(=O)c1nnc(Nc2ccc(N3CCCC3)cc2)nc1NC1CCC1 |
| InChI | InChI=1S/C18H23N7O/c19-16(26)15-17(20-12-4-3-5-12)22-18(24-23-15)21-13-6-8-14(9-7-13)25-10-1-2-11-25/h6-9,12H,1-5,10-11H2,(H2,19,26)(H2,20,21,22,24) |
| InChIKey | QQUJZNMROPTKIL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|