C20H21N5O — CID 11772395
3-(4-piperidin-1-ylanilino)quinoxaline-2-carboxamide (PubChem CID 11772395) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-(4-piperidin-1-ylanilino)quinoxaline-2-carboxamide.
| Compound Name | 3-(4-piperidin-1-ylanilino)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 11772395 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-(4-piperidin-1-ylanilino)quinoxaline-2-carboxamide |
| SMILES | NC(=O)c1nc2ccccc2nc1Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H21N5O/c21-19(26)18-20(24-17-7-3-2-6-16(17)23-18)22-14-8-10-15(11-9-14)25-12-4-1-5-13-25/h2-3,6-11H,1,4-5,12-13H2,(H2,21,26)(H,22,24) |
| InChIKey | FOKNOVKLFABKCC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|