C21H20ClFN4O2 — CID 147644204
2-(2-chloro-6-fluorophenyl)-5-(4-piperidin-1-ylanilino)-1,3-oxazole-4-carboxamide (PubChem CID 147644204) has the molecular formula C21H20ClFN4O2 and a molecular weight of 414.87 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-5-(4-piperidin-1-ylanilino)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-5-(4-piperidin-1-ylanilino)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 147644204 |
| Molecular Formula | C21H20ClFN4O2 |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-5-(4-piperidin-1-ylanilino)-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2c(F)cccc2Cl)oc1Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H20ClFN4O2/c22-15-5-4-6-16(23)17(15)20-26-18(19(24)28)21(29-20)25-13-7-9-14(10-8-13)27-11-2-1-3-12-27/h4-10,25H,1-3,11-12H2,(H2,24,28) |
| InChIKey | GIFJPBOPAUISAC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|