C20H17F2N5O3 — CID 59587595
2-(2,6-difluorophenyl)-5-[4-(3-oxopiperazin-1-yl)anilino]-1,3-oxazole-4-carboxamide (PubChem CID 59587595) has the molecular formula C20H17F2N5O3 and a molecular weight of 413.38 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[4-(3-oxopiperazin-1-yl)anilino]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-5-[4-(3-oxopiperazin-1-yl)anilino]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59587595 |
| Molecular Formula | C20H17F2N5O3 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[4-(3-oxopiperazin-1-yl)anilino]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2c(F)cccc2F)oc1Nc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C20H17F2N5O3/c21-13-2-1-3-14(22)16(13)19-26-17(18(23)29)20(30-19)25-11-4-6-12(7-5-11)27-9-8-24-15(28)10-27/h1-7,25H,8-10H2,(H2,23,29)(H,24,28) |
| InChIKey | TVZAIXFLVWEBLB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|