C22H25N5O2 — CID 59587513
2-(2,6-dimethylphenyl)-5-(4-piperazin-1-ylanilino)-1,3-oxazole-4-carboxamide (PubChem CID 59587513) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-5-(4-piperazin-1-ylanilino)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-dimethylphenyl)-5-(4-piperazin-1-ylanilino)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59587513 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-5-(4-piperazin-1-ylanilino)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1cccc(C)c1-c1nc(C(N)=O)c(Nc2ccc(N3CCNCC3)cc2)o1 |
| InChI | InChI=1S/C22H25N5O2/c1-14-4-3-5-15(2)18(14)21-26-19(20(23)28)22(29-21)25-16-6-8-17(9-7-16)27-12-10-24-11-13-27/h3-9,24-25H,10-13H2,1-2H3,(H2,23,28) |
| InChIKey | KDAFMVVNGSGPHS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|