C19H22N8O — CID 10293038
[5-methyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 10293038) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is [5-methyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | [5-methyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 10293038 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [5-methyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | Cc1cc(NC(N)=O)nc2nc(Nc3ccc(N4CCNCC4)cc3)ncc12 |
| InChI | InChI=1S/C19H22N8O/c1-12-10-16(25-18(20)28)24-17-15(12)11-22-19(26-17)23-13-2-4-14(5-3-13)27-8-6-21-7-9-27/h2-5,10-11,21H,6-9H2,1H3,(H4,20,22,23,24,25,26,28) |
| InChIKey | PGQSLDLNYLTRIQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|