C17H21N7O — CID 142733067
8-methyl-2-(4-piperazin-1-ylanilino)-6,7-dihydropyrimido[4,5-d]pyrimidin-5-one (PubChem CID 142733067) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 8-methyl-2-(4-piperazin-1-ylanilino)-6,7-dihydropyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 8-methyl-2-(4-piperazin-1-ylanilino)-6,7-dihydropyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 142733067 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 8-methyl-2-(4-piperazin-1-ylanilino)-6,7-dihydropyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CN1CNC(=O)c2cnc(Nc3ccc(N4CCNCC4)cc3)nc21 |
| InChI | InChI=1S/C17H21N7O/c1-23-11-20-16(25)14-10-19-17(22-15(14)23)21-12-2-4-13(5-3-12)24-8-6-18-7-9-24/h2-5,10,18H,6-9,11H2,1H3,(H,20,25)(H,19,21,22) |
| InChIKey | CFUYVGXINRLCBZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|