C24H26ClN7O — CID 122652846
6-(2-chlorophenyl)-8-methyl-2-[4-(3-methylpiperazin-1-yl)anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 122652846) has the molecular formula C24H26ClN7O and a molecular weight of 463.97 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-8-methyl-2-[4-(3-methylpiperazin-1-yl)anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 6-(2-chlorophenyl)-8-methyl-2-[4-(3-methylpiperazin-1-yl)anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 122652846 |
| Molecular Formula | C24H26ClN7O |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 6-(2-chlorophenyl)-8-methyl-2-[4-(3-methylpiperazin-1-yl)anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CC1CN(c2ccc(Nc3ncc4c(n3)N(C)CN(c3ccccc3Cl)C4=O)cc2)CCN1 |
| InChI | InChI=1S/C24H26ClN7O/c1-16-14-31(12-11-26-16)18-9-7-17(8-10-18)28-24-27-13-19-22(29-24)30(2)15-32(23(19)33)21-6-4-3-5-20(21)25/h3-10,13,16,26H,11-12,14-15H2,1-2H3,(H,27,28,29) |
| InChIKey | NPGKJNHXBDJTQI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|