C24H25Cl2N7O — CID 118189130
6-(2,6-dichlorophenyl)-8-ethyl-2-(4-piperazin-1-ylanilino)-7H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 118189130) has the molecular formula C24H25Cl2N7O and a molecular weight of 498.42 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-ethyl-2-(4-piperazin-1-ylanilino)-7H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-ethyl-2-(4-piperazin-1-ylanilino)-7H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118189130 |
| Molecular Formula | C24H25Cl2N7O |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-ethyl-2-(4-piperazin-1-ylanilino)-7H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CCN1CN(c2c(Cl)cccc2Cl)C(=O)c2cnc(Nc3ccc(N4CCNCC4)cc3)nc21 |
| InChI | InChI=1S/C24H25Cl2N7O/c1-2-31-15-33(21-19(25)4-3-5-20(21)26)23(34)18-14-28-24(30-22(18)31)29-16-6-8-17(9-7-16)32-12-10-27-11-13-32/h3-9,14,27H,2,10-13,15H2,1H3,(H,28,29,30) |
| InChIKey | FMPXJJDSJOHGPX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|