C26H27Cl2N7O2S — CID 155709818
3-(2,6-dichlorophenyl)-7-[4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 155709818) has the molecular formula C26H27Cl2N7O2S and a molecular weight of 572.52 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 155709818 |
| Molecular Formula | C26H27Cl2N7O2S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | CN(C)CC(=O)N1CCN(c2ccc(Nc3ncc4c(n3)SCN(c3c(Cl)cccc3Cl)C4=O)cc2)CC1 |
| InChI | InChI=1S/C26H27Cl2N7O2S/c1-32(2)15-22(36)34-12-10-33(11-13-34)18-8-6-17(7-9-18)30-26-29-14-19-24(31-26)38-16-35(25(19)37)23-20(27)4-3-5-21(23)28/h3-9,14H,10-13,15-16H2,1-2H3,(H,29,30,31) |
| InChIKey | JHDZOINJDMPTCL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|