C24H23Cl2N5OS — CID 138530926
3-(2,6-dichlorophenyl)-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138530926) has the molecular formula C24H23Cl2N5OS and a molecular weight of 500.46 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138530926 |
| Molecular Formula | C24H23Cl2N5OS |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | CN(C)C1CCc2cc(Nc3ncc4c(n3)SCN(c3c(Cl)cccc3Cl)C4=O)ccc2C1 |
| InChI | InChI=1S/C24H23Cl2N5OS/c1-30(2)17-9-7-14-10-16(8-6-15(14)11-17)28-24-27-12-18-22(29-24)33-13-31(23(18)32)21-19(25)4-3-5-20(21)26/h3-6,8,10,12,17H,7,9,11,13H2,1-2H3,(H,27,28,29) |
| InChIKey | KCUNWIZYOGXHBY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |