C24H23Cl2N5OS — CID 138531457
3-(2,6-dichlorophenyl)-7-[(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138531457) has the molecular formula C24H23Cl2N5OS and a molecular weight of 500.46 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138531457 |
| Molecular Formula | C24H23Cl2N5OS |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-6-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | CC(C)C1NCCc2cc(Nc3ncc4c(n3)SCN(c3c(Cl)cccc3Cl)C4=O)ccc21 |
| InChI | InChI=1S/C24H23Cl2N5OS/c1-13(2)20-16-7-6-15(10-14(16)8-9-27-20)29-24-28-11-17-22(30-24)33-12-31(23(17)32)21-18(25)4-3-5-19(21)26/h3-7,10-11,13,20,27H,8-9,12H2,1-2H3,(H,28,29,30) |
| InChIKey | HGSCRSQLDIWPEJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |