C23H21Cl2N5OS — CID 138521445
3-(2,6-dichlorophenyl)-7-[(4,4-dimethyl-2,3-dihydro-1H-isoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138521445) has the molecular formula C23H21Cl2N5OS and a molecular weight of 486.43 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[(4,4-dimethyl-2,3-dihydro-1H-isoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[(4,4-dimethyl-2,3-dihydro-1H-isoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138521445 |
| Molecular Formula | C23H21Cl2N5OS |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[(4,4-dimethyl-2,3-dihydro-1H-isoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | CC1(C)CNCc2cc(Nc3ncc4c(n3)SCN(c3c(Cl)cccc3Cl)C4=O)ccc21 |
| InChI | InChI=1S/C23H21Cl2N5OS/c1-23(2)11-26-9-13-8-14(6-7-16(13)23)28-22-27-10-15-20(29-22)32-12-30(21(15)31)19-17(24)4-3-5-18(19)25/h3-8,10,26H,9,11-12H2,1-2H3,(H,27,28,29) |
| InChIKey | FZFHCPMWEBQBFC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |