C21H17Cl2N5OS — CID 138531588
3-(2,5-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138531588) has the molecular formula C21H17Cl2N5OS and a molecular weight of 458.37 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2,5-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138531588 |
| Molecular Formula | C21H17Cl2N5OS |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc4c(c3)CNCC4)nc2SCN1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H17Cl2N5OS/c22-14-2-4-17(23)18(8-14)28-11-30-19-16(20(28)29)10-25-21(27-19)26-15-3-1-12-5-6-24-9-13(12)7-15/h1-4,7-8,10,24H,5-6,9,11H2,(H,25,26,27) |
| InChIKey | OYRYQNXHAXFMKJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |