C23H21ClFN5OS — CID 164779212
3-(2-chloro-6-fluorophenyl)-2,2-dimethyl-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 164779212) has the molecular formula C23H21ClFN5OS and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2,2-dimethyl-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-2,2-dimethyl-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 164779212 |
| Molecular Formula | C23H21ClFN5OS |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-2,2-dimethyl-7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | CC1(C)Sc2nc(Nc3ccc4c(c3)CNCC4)ncc2C(=O)N1c1c(F)cccc1Cl |
| InChI | InChI=1S/C23H21ClFN5OS/c1-23(2)30(19-17(24)4-3-5-18(19)25)21(31)16-12-27-22(29-20(16)32-23)28-15-7-6-13-8-9-26-11-14(13)10-15/h3-7,10,12,26H,8-9,11H2,1-2H3,(H,27,28,29) |
| InChIKey | GJOBHHHMLMYKJX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |