C24H23Cl2N5O2 — CID 155201643
3-(2,6-dichlorophenyl)-2,2-dimethyl-7-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 155201643) has the molecular formula C24H23Cl2N5O2 and a molecular weight of 484.39 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2,2-dimethyl-7-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-2,2-dimethyl-7-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 155201643 |
| Molecular Formula | C24H23Cl2N5O2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2,2-dimethyl-7-[(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)amino]pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CN1CCc2ccc(Nc3ncc4c(n3)OC(C)(C)N(c3c(Cl)cccc3Cl)C4=O)cc2C1 |
| InChI | InChI=1S/C24H23Cl2N5O2/c1-24(2)31(20-18(25)5-4-6-19(20)26)22(32)17-12-27-23(29-21(17)33-24)28-16-8-7-14-9-10-30(3)13-15(14)11-16/h4-8,11-12H,9-10,13H2,1-3H3,(H,27,28,29) |
| InChIKey | CCNNDMZCZLMPBT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |