C25H22Cl2N6O2 — CID 138531563
6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1,2-trimethyl-3,4-dihydroisoquinoline-8-carbonitrile (PubChem CID 138531563) has the molecular formula C25H22Cl2N6O2 and a molecular weight of 509.40 g/mol. Its IUPAC name is 6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1,2-trimethyl-3,4-dihydroisoquinoline-8-carbonitrile.
| Compound Name | 6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1,2-trimethyl-3,4-dihydroisoquinoline-8-carbonitrile |
|---|---|
| PubChem CID | 138531563 |
| Molecular Formula | C25H22Cl2N6O2 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1,2-trimethyl-3,4-dihydroisoquinoline-8-carbonitrile |
| SMILES | CN1CCc2cc(Nc3ncc4c(n3)OCN(c3c(Cl)cccc3Cl)C4=O)cc(C#N)c2C1(C)C |
| InChI | InChI=1S/C25H22Cl2N6O2/c1-25(2)20-14(7-8-32(25)3)9-16(10-15(20)11-28)30-24-29-12-17-22(31-24)35-13-33(23(17)34)21-18(26)5-4-6-19(21)27/h4-6,9-10,12H,7-8,13H2,1-3H3,(H,29,30,31) |
| InChIKey | YWHUJMILSZMGKD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |