C24H20Cl2F3N5O2 — CID 138531236
3-(2,6-dichlorophenyl)-7-[[2-(3,3,3-trifluoropropyl)-3,4-dihydro-1H-isoquinolin-6-yl]amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138531236) has the molecular formula C24H20Cl2F3N5O2 and a molecular weight of 538.36 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[[2-(3,3,3-trifluoropropyl)-3,4-dihydro-1H-isoquinolin-6-yl]amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[[2-(3,3,3-trifluoropropyl)-3,4-dihydro-1H-isoquinolin-6-yl]amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138531236 |
| Molecular Formula | C24H20Cl2F3N5O2 |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[[2-(3,3,3-trifluoropropyl)-3,4-dihydro-1H-isoquinolin-6-yl]amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc4c(c3)CCN(CCC(F)(F)F)C4)nc2OCN1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H20Cl2F3N5O2/c25-18-2-1-3-19(26)20(18)34-13-36-21-17(22(34)35)11-30-23(32-21)31-16-5-4-15-12-33(8-6-14(15)10-16)9-7-24(27,28)29/h1-5,10-11H,6-9,12-13H2,(H,30,31,32) |
| InChIKey | PLIXHBSVXWZOKP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |