C23H19Cl2N5O3 — CID 138530951
7-[(5-acetyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138530951) has the molecular formula C23H19Cl2N5O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is 7-[(5-acetyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 7-[(5-acetyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138530951 |
| Molecular Formula | C23H19Cl2N5O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 7-[(5-acetyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CC(=O)c1cc(Nc2ncc3c(n2)OCN(c2c(Cl)cccc2Cl)C3=O)cc2c1CCNC2 |
| InChI | InChI=1S/C23H19Cl2N5O3/c1-12(31)16-8-14(7-13-9-26-6-5-15(13)16)28-23-27-10-17-21(29-23)33-11-30(22(17)32)20-18(24)3-2-4-19(20)25/h2-4,7-8,10,26H,5-6,9,11H2,1H3,(H,27,28,29) |
| InChIKey | SQHSYKRUTFHKCH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |