C22H19Cl2N5O2 — CID 138531221
3-(2,6-dichlorophenyl)-7-[(1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138531221) has the molecular formula C22H19Cl2N5O2 and a molecular weight of 456.33 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[(1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[(1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138531221 |
| Molecular Formula | C22H19Cl2N5O2 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[(1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CC1NCCc2ccc(Nc3ncc4c(n3)OCN(c3c(Cl)cccc3Cl)C4=O)cc21 |
| InChI | InChI=1S/C22H19Cl2N5O2/c1-12-15-9-14(6-5-13(15)7-8-25-12)27-22-26-10-16-20(28-22)31-11-29(21(16)30)19-17(23)3-2-4-18(19)24/h2-6,9-10,12,25H,7-8,11H2,1H3,(H,26,27,28) |
| InChIKey | CZHABBDORVVKIL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |