C29H31Cl2N5O4 — CID 155201601
tert-butyl 6-[[3-(2,6-dichlorophenyl)-2-methyl-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1-dimethyl-3,4-dihydroisoquinoline-2-carboxylate (PubChem CID 155201601) has the molecular formula C29H31Cl2N5O4 and a molecular weight of 584.50 g/mol. Its IUPAC name is tert-butyl 6-[[3-(2,6-dichlorophenyl)-2-methyl-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1-dimethyl-3,4-dihydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-[[3-(2,6-dichlorophenyl)-2-methyl-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1-dimethyl-3,4-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155201601 |
| Molecular Formula | C29H31Cl2N5O4 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | tert-butyl 6-[[3-(2,6-dichlorophenyl)-2-methyl-4-oxo-2H-pyrimido[5,4-e][1,3]oxazin-7-yl]amino]-1,1-dimethyl-3,4-dihydroisoquinoline-2-carboxylate |
| SMILES | CC1Oc2nc(Nc3ccc4c(c3)CCN(C(=O)OC(C)(C)C)C4(C)C)ncc2C(=O)N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H31Cl2N5O4/c1-16-36(23-21(30)8-7-9-22(23)31)25(37)19-15-32-26(34-24(19)39-16)33-18-10-11-20-17(14-18)12-13-35(29(20,5)6)27(38)40-28(2,3)4/h7-11,14-16H,12-13H2,1-6H3,(H,32,33,34) |
| InChIKey | BXUMMCVWAITXIC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |