C22H18Cl2N6O — CID 71224163
6-(2,6-dichlorophenyl)-8-methyl-2-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[4,5-d]pyridazin-5-one (PubChem CID 71224163) has the molecular formula C22H18Cl2N6O and a molecular weight of 453.33 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71224163 |
| Molecular Formula | C22H18Cl2N6O |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrimido[4,5-d]pyridazin-5-one |
| SMILES | Cc1nn(-c2c(Cl)cccc2Cl)c(=O)c2cnc(Nc3ccc4c(c3)CNCC4)nc12 |
| InChI | InChI=1S/C22H18Cl2N6O/c1-12-19-16(21(31)30(29-12)20-17(23)3-2-4-18(20)24)11-26-22(28-19)27-15-6-5-13-7-8-25-10-14(13)9-15/h2-6,9,11,25H,7-8,10H2,1H3,(H,26,27,28) |
| InChIKey | HQVAPGFBIOJUSQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |