C21H19F2N7 — CID 142470051
3-N-(2,6-difluorophenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 142470051) has the molecular formula C21H19F2N7 and a molecular weight of 407.43 g/mol. Its IUPAC name is 3-N-(2,6-difluorophenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 3-N-(2,6-difluorophenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 142470051 |
| Molecular Formula | C21H19F2N7 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-N-(2,6-difluorophenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | Cn1nc(Nc2c(F)cccc2F)c2cnc(Nc3ccc4c(c3)CNCC4)nc21 |
| InChI | InChI=1S/C21H19F2N7/c1-30-20-15(19(29-30)27-18-16(22)3-2-4-17(18)23)11-25-21(28-20)26-14-6-5-12-7-8-24-10-13(12)9-14/h2-6,9,11,24H,7-8,10H2,1H3,(H,27,29)(H,25,26,28) |
| InChIKey | AZFMLDPTRAJNLH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |