C24H28N8 — CID 166545794
3-N-(2,6-dimethylphenyl)-1-methyl-6-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 166545794) has the molecular formula C24H28N8 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-N-(2,6-dimethylphenyl)-1-methyl-6-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 3-N-(2,6-dimethylphenyl)-1-methyl-6-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 166545794 |
| Molecular Formula | C24H28N8 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-N-(2,6-dimethylphenyl)-1-methyl-6-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | Cc1cccc(C)c1Nc1nn(C)c2nc(Nc3ccc(N4CCNCC4)cc3)ncc12 |
| InChI | InChI=1S/C24H28N8/c1-16-5-4-6-17(2)21(16)28-22-20-15-26-24(29-23(20)31(3)30-22)27-18-7-9-19(10-8-18)32-13-11-25-12-14-32/h4-10,15,25H,11-14H2,1-3H3,(H,28,30)(H,26,27,29) |
| InChIKey | LXVSRIAMDFXNQZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|