C21H17Cl2N7O — CID 58289970
4-amino-3-(2,6-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 58289970) has the molecular formula C21H17Cl2N7O and a molecular weight of 454.32 g/mol. Its IUPAC name is 4-amino-3-(2,6-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 4-amino-3-(2,6-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 58289970 |
| Molecular Formula | C21H17Cl2N7O |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 4-amino-3-(2,6-dichlorophenyl)-7-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | Nc1c2cnc(Nc3ccc4c(c3)CCNC4)nc2nc(=O)n1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H17Cl2N7O/c22-15-2-1-3-16(23)17(15)30-18(24)14-10-26-20(28-19(14)29-21(30)31)27-13-5-4-12-9-25-7-6-11(12)8-13/h1-5,8,10,25H,6-7,9,24H2,(H,27,28,29,31) |
| InChIKey | ULQADWJZPYGWKP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |