C25H25Cl2N7O — CID 25164715
4-amino-3-(2,6-dichlorophenyl)-7-[[6-[(dimethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 25164715) has the molecular formula C25H25Cl2N7O and a molecular weight of 510.43 g/mol. Its IUPAC name is 4-amino-3-(2,6-dichlorophenyl)-7-[[6-[(dimethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 4-amino-3-(2,6-dichlorophenyl)-7-[[6-[(dimethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 25164715 |
| Molecular Formula | C25H25Cl2N7O |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 4-amino-3-(2,6-dichlorophenyl)-7-[[6-[(dimethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CN(C)CC1CCc2cc(Nc3ncc4c(N)n(-c5c(Cl)cccc5Cl)c(=O)nc4n3)ccc2C1 |
| InChI | InChI=1S/C25H25Cl2N7O/c1-33(2)13-14-6-7-16-11-17(9-8-15(16)10-14)30-24-29-12-18-22(28)34(25(35)32-23(18)31-24)21-19(26)4-3-5-20(21)27/h3-5,8-9,11-12,14H,6-7,10,13,28H2,1-2H3,(H,30,31,32,35) |
| InChIKey | UJMLTKFEEXLGDR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |