C24H25Cl2N7O2 — CID 58455471
4-amino-3-(2,6-dichlorophenyl)-7-[3-[3-(dimethylamino)propoxy]-4-methylanilino]pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 58455471) has the molecular formula C24H25Cl2N7O2 and a molecular weight of 514.42 g/mol. Its IUPAC name is 4-amino-3-(2,6-dichlorophenyl)-7-[3-[3-(dimethylamino)propoxy]-4-methylanilino]pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 4-amino-3-(2,6-dichlorophenyl)-7-[3-[3-(dimethylamino)propoxy]-4-methylanilino]pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 58455471 |
| Molecular Formula | C24H25Cl2N7O2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 4-amino-3-(2,6-dichlorophenyl)-7-[3-[3-(dimethylamino)propoxy]-4-methylanilino]pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | Cc1ccc(Nc2ncc3c(N)n(-c4c(Cl)cccc4Cl)c(=O)nc3n2)cc1OCCCN(C)C |
| InChI | InChI=1S/C24H25Cl2N7O2/c1-14-8-9-15(12-19(14)35-11-5-10-32(2)3)29-23-28-13-16-21(27)33(24(34)31-22(16)30-23)20-17(25)6-4-7-18(20)26/h4,6-9,12-13H,5,10-11,27H2,1-3H3,(H,29,30,31,34) |
| InChIKey | VXZKSKHYBFHWCE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|